C34H32FN5O4 — CID 138472802
(2R,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-(fluoromethyl)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolane-2-carbonitrile (PubChem CID 138472802) has the molecular formula C34H32FN5O4 and a molecular weight of 593.66 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-(fluoromethyl)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolane-2-carbonitrile.
| Compound Name | (2R,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-(fluoromethyl)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolane-2-carbonitrile |
|---|---|
| PubChem CID | 138472802 |
| Molecular Formula | C34H32FN5O4 |
| Molecular Weight | 593.66 g/mol |
| Exact Mass | 593.24 |
| IUPAC Name | (2R,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-(fluoromethyl)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolane-2-carbonitrile |
| SMILES | N#C[C@@]1(c2ccc3c(N)ncnn23)O[C@](CF)(COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C34H32FN5O4/c35-21-33(23-41-18-25-10-4-1-5-11-25)30(42-19-26-12-6-2-7-13-26)31(43-20-27-14-8-3-9-15-27)34(22-36,44-33)29-17-16-28-32(37)38-24-39-40(28)29/h1-17,24,30-31H,18-21,23H2,(H2,37,38,39)/t30-,31+,33+,34-/m0/s1 |
| InChIKey | VQMBOFPITGHJDB-CWGTVQHUSA-N |
| XLogP | 5.16 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.66 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |