C23H24FN6O9P — CID 138472827
(2R)-2-[[[(3aR,4R,6S,6aS)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-6-fluoro-2-methoxy-3a,6a-dihydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid (PubChem CID 138472827) has the molecular formula C23H24FN6O9P and a molecular weight of 578.45 g/mol. Its IUPAC name is (2R)-2-[[[(3aR,4R,6S,6aS)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-6-fluoro-2-methoxy-3a,6a-dihydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid.
| Compound Name | (2R)-2-[[[(3aR,4R,6S,6aS)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-6-fluoro-2-methoxy-3a,6a-dihydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid |
|---|---|
| PubChem CID | 138472827 |
| Molecular Formula | C23H24FN6O9P |
| Molecular Weight | 578.45 g/mol |
| Exact Mass | 578.13 |
| IUPAC Name | (2R)-2-[[[(3aR,4R,6S,6aS)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-6-fluoro-2-methoxy-3a,6a-dihydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid |
| SMILES | COC1O[C@@H]2[C@H](O1)[C@@](F)(COP(=O)(N[C@H](C)C(=O)O)Oc1ccccc1)O[C@@]2(C#N)c1ccc2c(N)ncnn12 |
| InChI | InChI=1S/C23H24FN6O9P/c1-13(20(31)32)29-40(33,38-14-6-4-3-5-7-14)35-11-23(24)18-17(36-21(34-2)37-18)22(10-25,39-23)16-9-8-15-19(26)27-12-28-30(15)16/h3-9,12-13,17-18,21H,11H2,1-2H3,(H,29,33)(H,31,32)(H2,26,27,28)/t13-,17-,18+,21?,22+,23-,40?/m1/s1 |
| InChIKey | IRVSIIDQCQGANO-QFHCUDLBSA-N |
| XLogP | 1.71 |
| TPSA | 201.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.45 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|