C9H13FN5O14P3 — CID 138473656
[[(2R,3S,5R)-4-azido-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 138473656) has the molecular formula C9H13FN5O14P3 and a molecular weight of 527.14 g/mol. Its IUPAC name is [[(2R,3S,5R)-4-azido-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,5R)-4-azido-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 138473656 |
| Molecular Formula | C9H13FN5O14P3 |
| Molecular Weight | 527.14 g/mol |
| Exact Mass | 526.97 |
| IUPAC Name | [[(2R,3S,5R)-4-azido-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | [N-]=[N+]=NC1[C@H](n2cc(F)c(=O)[nH]c2=O)O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H]1O |
| InChI | InChI=1S/C9H13FN5O14P3/c10-3-1-15(9(18)12-7(3)17)8-5(13-14-11)6(16)4(27-8)2-26-31(22,23)29-32(24,25)28-30(19,20)21/h1,4-6,8,16H,2H2,(H,22,23)(H,24,25)(H,12,17,18)(H2,19,20,21)/t4-,5?,6-,8-/m1/s1 |
| InChIKey | OQPRDJKVWZFHCN-CQWREQHLSA-N |
| XLogP | -1.04 |
| TPSA | 292.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.14 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|