C16H30O2 — CID 138474293
(5S,8R)-8-(3,6-dihydro-2H-pyran-6-yl)-4,5-dimethylnonan-1-ol (PubChem CID 138474293) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is (5S,8R)-8-(3,6-dihydro-2H-pyran-6-yl)-4,5-dimethylnonan-1-ol.
| Compound Name | (5S,8R)-8-(3,6-dihydro-2H-pyran-6-yl)-4,5-dimethylnonan-1-ol |
|---|---|
| PubChem CID | 138474293 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | (5S,8R)-8-(3,6-dihydro-2H-pyran-6-yl)-4,5-dimethylnonan-1-ol |
| SMILES | CC(CCCO)[C@@H](C)CC[C@@H](C)C1C=CCCO1 |
| InChI | InChI=1S/C16H30O2/c1-13(7-6-11-17)14(2)9-10-15(3)16-8-4-5-12-18-16/h4,8,13-17H,5-7,9-12H2,1-3H3/t13?,14-,15+,16?/m0/s1 |
| InChIKey | AGJPFBRXVLZUBH-PWUWZPNHSA-N |
| XLogP | 3.79 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|