C22H34S — CID 138474649
2-[(2E)-3,5-dimethylhexa-2,4-dien-2-yl]-5-[(2E,4E)-3,5,6-trimethylhepta-2,4-dien-2-yl]-2,3-dihydrothiophene (PubChem CID 138474649) has the molecular formula C22H34S and a molecular weight of 330.58 g/mol. Its IUPAC name is 2-[(2E)-3,5-dimethylhexa-2,4-dien-2-yl]-5-[(2E,4E)-3,5,6-trimethylhepta-2,4-dien-2-yl]-2,3-dihydrothiophene.
| Compound Name | 2-[(2E)-3,5-dimethylhexa-2,4-dien-2-yl]-5-[(2E,4E)-3,5,6-trimethylhepta-2,4-dien-2-yl]-2,3-dihydrothiophene |
|---|---|
| PubChem CID | 138474649 |
| Molecular Formula | C22H34S |
| Molecular Weight | 330.58 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | 2-[(2E)-3,5-dimethylhexa-2,4-dien-2-yl]-5-[(2E,4E)-3,5,6-trimethylhepta-2,4-dien-2-yl]-2,3-dihydrothiophene |
| SMILES | CC(C)=C/C(C)=C(\C)C1CC=C(/C(C)=C(C)/C=C(\C)C(C)C)S1 |
| InChI | InChI=1S/C22H34S/c1-14(2)12-17(6)19(8)21-10-11-22(23-21)20(9)18(7)13-16(5)15(3)4/h11-13,15,21H,10H2,1-9H3/b16-13+,19-17+,20-18+ |
| InChIKey | GWQIVJRGDRGLNN-YZKZUNCJSA-N |
| XLogP | 7.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.58 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|