C11H23N — CID 138474859
N,N-dimethyl-1-(4-methylcyclohexyl)ethanamine (PubChem CID 138474859) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is N,N-dimethyl-1-(4-methylcyclohexyl)ethanamine.
| Compound Name | N,N-dimethyl-1-(4-methylcyclohexyl)ethanamine |
|---|---|
| PubChem CID | 138474859 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | N,N-dimethyl-1-(4-methylcyclohexyl)ethanamine |
| SMILES | CC1CCC(C(C)N(C)C)CC1 |
| InChI | InChI=1S/C11H23N/c1-9-5-7-11(8-6-9)10(2)12(3)4/h9-11H,5-8H2,1-4H3 |
| InChIKey | BBMOTVRXOQTWEW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |