C20H35N — CID 138474865
(E)-N-ethenyl-5,9,9-trimethyl-7-methylidene-N-(2-methylprop-2-enyl)dec-2-en-4-amine (PubChem CID 138474865) has the molecular formula C20H35N and a molecular weight of 289.51 g/mol. Its IUPAC name is (E)-N-ethenyl-5,9,9-trimethyl-7-methylidene-N-(2-methylprop-2-enyl)dec-2-en-4-amine.
| Compound Name | (E)-N-ethenyl-5,9,9-trimethyl-7-methylidene-N-(2-methylprop-2-enyl)dec-2-en-4-amine |
|---|---|
| PubChem CID | 138474865 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | (E)-N-ethenyl-5,9,9-trimethyl-7-methylidene-N-(2-methylprop-2-enyl)dec-2-en-4-amine |
| SMILES | C=CN(CC(=C)C)C(/C=C/C)C(C)CC(=C)CC(C)(C)C |
| InChI | InChI=1S/C20H35N/c1-10-12-19(21(11-2)15-16(3)4)18(6)13-17(5)14-20(7,8)9/h10-12,18-19H,2-3,5,13-15H2,1,4,6-9H3/b12-10+ |
| InChIKey | DBPBGUZWSIPGFY-ZRDIBKRKSA-N |
| XLogP | 5.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|