C63H39N5O — CID 138475052
2-[8-[3-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-3-yl]phenyl]dibenzofuran-1-yl]-9-phenylcarbazole (PubChem CID 138475052) has the molecular formula C63H39N5O and a molecular weight of 882.04 g/mol. Its IUPAC name is 2-[8-[3-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-3-yl]phenyl]dibenzofuran-1-yl]-9-phenylcarbazole.
| Compound Name | 2-[8-[3-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-3-yl]phenyl]dibenzofuran-1-yl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 138475052 |
| Molecular Formula | C63H39N5O |
| Molecular Weight | 882.04 g/mol |
| Exact Mass | 881.32 |
| IUPAC Name | 2-[8-[3-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-3-yl]phenyl]dibenzofuran-1-yl]-9-phenylcarbazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-n3c4ccccc4c4cc(-c5cccc(-c6ccc7oc8cccc(-c9ccc%10c%11ccccc%11n(-c%11ccccc%11)c%10c9)c8c7c6)c5)ccc43)n2)cc1 |
| InChI | InChI=1S/C63H39N5O/c1-4-16-40(17-5-1)61-64-62(41-18-6-2-7-19-41)66-63(65-61)68-55-28-13-11-25-50(55)52-37-44(31-34-56(52)68)42-20-14-21-43(36-42)45-32-35-58-53(38-45)60-48(26-15-29-59(60)69-58)46-30-33-51-49-24-10-12-27-54(49)67(57(51)39-46)47-22-8-3-9-23-47/h1-39H |
| InChIKey | DETWHPBMUGICHK-UHFFFAOYSA-N |
| XLogP | 16.30 |
| TPSA | 61.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.04 |
| LogP ≤ 5 | 16.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |