C31H55N3O2 — CID 138475309
6-[4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoylamino]-2-(methylamino)hexanamide (PubChem CID 138475309) has the molecular formula C31H55N3O2 and a molecular weight of 501.80 g/mol. Its IUPAC name is 6-[4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoylamino]-2-(methylamino)hexanamide.
| Compound Name | 6-[4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoylamino]-2-(methylamino)hexanamide |
|---|---|
| PubChem CID | 138475309 |
| Molecular Formula | C31H55N3O2 |
| Molecular Weight | 501.80 g/mol |
| Exact Mass | 501.43 |
| IUPAC Name | 6-[4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoylamino]-2-(methylamino)hexanamide |
| SMILES | CNC(CCCCNC(=O)CCC(C)C1CCC2C3CCC4CCCCC4(C)C3CCC12C)C(N)=O |
| InChI | InChI=1S/C31H55N3O2/c1-21(11-16-28(35)34-20-8-6-10-27(33-4)29(32)36)24-14-15-25-23-13-12-22-9-5-7-18-30(22,2)26(23)17-19-31(24,25)3/h21-27,33H,5-20H2,1-4H3,(H2,32,36)(H,34,35) |
| InChIKey | JMPBNWLVSMXXCW-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.80 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|