About 5-[methyl(propan-2-yl)amino]hexa-1,5-diene-3-thiol
5-[methyl(propan-2-yl)amino]hexa-1,5-diene-3-thiol (PubChem CID 138475630) has the molecular formula C10H19NS
and a molecular weight of 185.34 g/mol. Its IUPAC name is 5-[methyl(propan-2-yl)amino]hexa-1,5-diene-3-thiol.
Molecular Properties
| Compound Name | 5-[methyl(propan-2-yl)amino]hexa-1,5-diene-3-thiol |
| PubChem CID | 138475630 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 5-[methyl(propan-2-yl)amino]hexa-1,5-diene-3-thiol |
| SMILES | C=CC(S)CC(=C)N(C)C(C)C |
| InChI | InChI=1S/C10H19NS/c1-6-10(12)7-9(4)11(5)8(2)3/h6,8,10,12H,1,4,7H2,2-3,5H3 |
| InChIKey | LRQFQIWZVIRULU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-[methyl(propan-2-yl)amino]hexa-1,5-diene-3-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[methyl(propan-2-yl)amino]hexa-1,5-diene-3-thiol?
The IUPAC name of 5-[methyl(propan-2-yl)amino]hexa-1,5-diene-3-thiol (CID 138475630) is 5-[methyl(propan-2-yl)amino]hexa-1,5-diene-3-thiol.
What is the SMILES notation for 5-[methyl(propan-2-yl)amino]hexa-1,5-diene-3-thiol?
The canonical SMILES for 5-[methyl(propan-2-yl)amino]hexa-1,5-diene-3-thiol is C=CC(S)CC(=C)N(C)C(C)C.
What is the InChIKey of 5-[methyl(propan-2-yl)amino]hexa-1,5-diene-3-thiol?
The InChIKey is LRQFQIWZVIRULU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NS/c1-6-10(12)7-9(4)11(5)8(2)3/h6,8,10,12H,1,4,7H2,2-3,5H3.
What are the key properties of 5-[methyl(propan-2-yl)amino]hexa-1,5-diene-3-thiol?
5-[methyl(propan-2-yl)amino]hexa-1,5-diene-3-thiol has a molecular weight of 185.34 g/mol, XLogP of 2.71, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[methyl(propan-2-yl)amino]hexa-1,5-diene-3-thiol is sourced from PubChem (CID 138475630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).