C30H28ClF3N2O7S — CID 138475724
2-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]-1-cyclopropyl-N-[2-hydroxy-1-[4-(1,1,2,2,2-pentahydroxyethylsulfanyl)phenyl]ethyl]indole-5-carboxamide (PubChem CID 138475724) has the molecular formula C30H28ClF3N2O7S and a molecular weight of 653.08 g/mol. Its IUPAC name is 2-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]-1-cyclopropyl-N-[2-hydroxy-1-[4-(1,1,2,2,2-pentahydroxyethylsulfanyl)phenyl]ethyl]indole-5-carboxamide.
| Compound Name | 2-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]-1-cyclopropyl-N-[2-hydroxy-1-[4-(1,1,2,2,2-pentahydroxyethylsulfanyl)phenyl]ethyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 138475724 |
| Molecular Formula | C30H28ClF3N2O7S |
| Molecular Weight | 653.08 g/mol |
| Exact Mass | 652.13 |
| IUPAC Name | 2-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]-1-cyclopropyl-N-[2-hydroxy-1-[4-(1,1,2,2,2-pentahydroxyethylsulfanyl)phenyl]ethyl]indole-5-carboxamide |
| SMILES | O=C(NC(CO)c1ccc(SC(O)(O)C(O)(O)O)cc1)c1ccc2c(c1)cc(Cc1ccc(Cl)cc1C(F)(F)F)n2C1CC1 |
| InChI | InChI=1S/C30H28ClF3N2O7S/c31-20-5-1-17(24(14-20)28(32,33)34)12-22-13-19-11-18(4-10-26(19)36(22)21-6-7-21)27(38)35-25(15-37)16-2-8-23(9-3-16)44-30(42,43)29(39,40)41/h1-5,8-11,13-14,21,25,37,39-43H,6-7,12,15H2,(H,35,38) |
| InChIKey | VBVRONUGKPLUIG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 155.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.08 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|