C9H11N — CID 138477765
N-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]methanimine (PubChem CID 138477765) has the molecular formula C9H11N and a molecular weight of 133.19 g/mol. Its IUPAC name is N-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]methanimine.
| Compound Name | N-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]methanimine |
|---|---|
| PubChem CID | 138477765 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | N-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]methanimine |
| SMILES | C=C/C=C\C(=C/C=C)N=C |
| InChI | InChI=1S/C9H11N/c1-4-6-8-9(10-3)7-5-2/h4-8H,1-3H2/b8-6-,9-7+ |
| InChIKey | NFWGXVNFKJWELV-MKKAVFGOSA-N |
| XLogP | 2.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|