C15H14O6 — CID 138477939
4,6-dimethyl-4-(4-methyl-2,5-dioxofuran-3-yl)-5,7a-dihydro-3aH-2-benzofuran-1,3-dione (PubChem CID 138477939) has the molecular formula C15H14O6 and a molecular weight of 290.27 g/mol. Its IUPAC name is 4,6-dimethyl-4-(4-methyl-2,5-dioxofuran-3-yl)-5,7a-dihydro-3aH-2-benzofuran-1,3-dione.
| Compound Name | 4,6-dimethyl-4-(4-methyl-2,5-dioxofuran-3-yl)-5,7a-dihydro-3aH-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 138477939 |
| Molecular Formula | C15H14O6 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 4,6-dimethyl-4-(4-methyl-2,5-dioxofuran-3-yl)-5,7a-dihydro-3aH-2-benzofuran-1,3-dione |
| SMILES | CC1=CC2C(=O)OC(=O)C2C(C)(C2=C(C)C(=O)OC2=O)C1 |
| InChI | InChI=1S/C15H14O6/c1-6-4-8-10(14(19)21-12(8)17)15(3,5-6)9-7(2)11(16)20-13(9)18/h4,8,10H,5H2,1-3H3 |
| InChIKey | JMLVTZUYNZZNKJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|