About (4E)-4-[(3Z)-hexa-3,5-dien-2-ylidene]-3-methyl-1,5-dihydropyrazole
(4E)-4-[(3Z)-hexa-3,5-dien-2-ylidene]-3-methyl-1,5-dihydropyrazole (PubChem CID 138478028) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is (4E)-4-[(3Z)-hexa-3,5-dien-2-ylidene]-3-methyl-1,5-dihydropyrazole.
Molecular Properties
| Compound Name | (4E)-4-[(3Z)-hexa-3,5-dien-2-ylidene]-3-methyl-1,5-dihydropyrazole |
| PubChem CID | 138478028 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | (4E)-4-[(3Z)-hexa-3,5-dien-2-ylidene]-3-methyl-1,5-dihydropyrazole |
| SMILES | C=C/C=C\C(C)=C1/CNN=C1C |
| InChI | InChI=1S/C10H14N2/c1-4-5-6-8(2)10-7-11-12-9(10)3/h4-6,11H,1,7H2,2-3H3/b6-5-,10-8+ |
| InChIKey | JMANWZDIGZEGHL-UGXDAERVSA-N |
| XLogP | 2.02 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-4-[(3Z)-hexa-3,5-dien-2-ylidene]-3-methyl-1,5-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-[(3Z)-hexa-3,5-dien-2-ylidene]-3-methyl-1,5-dihydropyrazole?
The IUPAC name of (4E)-4-[(3Z)-hexa-3,5-dien-2-ylidene]-3-methyl-1,5-dihydropyrazole (CID 138478028) is (4E)-4-[(3Z)-hexa-3,5-dien-2-ylidene]-3-methyl-1,5-dihydropyrazole.
What is the SMILES notation for (4E)-4-[(3Z)-hexa-3,5-dien-2-ylidene]-3-methyl-1,5-dihydropyrazole?
The canonical SMILES for (4E)-4-[(3Z)-hexa-3,5-dien-2-ylidene]-3-methyl-1,5-dihydropyrazole is C=C/C=C\C(C)=C1/CNN=C1C.
What is the InChIKey of (4E)-4-[(3Z)-hexa-3,5-dien-2-ylidene]-3-methyl-1,5-dihydropyrazole?
The InChIKey is JMANWZDIGZEGHL-UGXDAERVSA-N. The full InChI is InChI=1S/C10H14N2/c1-4-5-6-8(2)10-7-11-12-9(10)3/h4-6,11H,1,7H2,2-3H3/b6-5-,10-8+.
What are the key properties of (4E)-4-[(3Z)-hexa-3,5-dien-2-ylidene]-3-methyl-1,5-dihydropyrazole?
(4E)-4-[(3Z)-hexa-3,5-dien-2-ylidene]-3-methyl-1,5-dihydropyrazole has a molecular weight of 162.24 g/mol, XLogP of 2.02, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-[(3Z)-hexa-3,5-dien-2-ylidene]-3-methyl-1,5-dihydropyrazole is sourced from PubChem (CID 138478028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).