About (1S)-1-(cyclohexa-1,3-dien-1-ylmethylamino)ethanol
(1S)-1-(cyclohexa-1,3-dien-1-ylmethylamino)ethanol (PubChem CID 138478123) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is (1S)-1-(cyclohexa-1,3-dien-1-ylmethylamino)ethanol.
Molecular Properties
| Compound Name | (1S)-1-(cyclohexa-1,3-dien-1-ylmethylamino)ethanol |
| PubChem CID | 138478123 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (1S)-1-(cyclohexa-1,3-dien-1-ylmethylamino)ethanol |
| SMILES | C[C@H](O)NCC1=CC=CCC1 |
| InChI | InChI=1S/C9H15NO/c1-8(11)10-7-9-5-3-2-4-6-9/h2-3,5,8,10-11H,4,6-7H2,1H3/t8-/m0/s1 |
| InChIKey | NOYDQIXHJQSUGB-QMMMGPOBSA-N |
| XLogP | 1.19 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-(cyclohexa-1,3-dien-1-ylmethylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(cyclohexa-1,3-dien-1-ylmethylamino)ethanol?
The IUPAC name of (1S)-1-(cyclohexa-1,3-dien-1-ylmethylamino)ethanol (CID 138478123) is (1S)-1-(cyclohexa-1,3-dien-1-ylmethylamino)ethanol.
What is the SMILES notation for (1S)-1-(cyclohexa-1,3-dien-1-ylmethylamino)ethanol?
The canonical SMILES for (1S)-1-(cyclohexa-1,3-dien-1-ylmethylamino)ethanol is C[C@H](O)NCC1=CC=CCC1.
What is the InChIKey of (1S)-1-(cyclohexa-1,3-dien-1-ylmethylamino)ethanol?
The InChIKey is NOYDQIXHJQSUGB-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H15NO/c1-8(11)10-7-9-5-3-2-4-6-9/h2-3,5,8,10-11H,4,6-7H2,1H3/t8-/m0/s1.
What are the key properties of (1S)-1-(cyclohexa-1,3-dien-1-ylmethylamino)ethanol?
(1S)-1-(cyclohexa-1,3-dien-1-ylmethylamino)ethanol has a molecular weight of 153.22 g/mol, XLogP of 1.19, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(cyclohexa-1,3-dien-1-ylmethylamino)ethanol is sourced from PubChem (CID 138478123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).