About N-(fluoromethyl)-1-[3-[(Z)-prop-1-enyl]cyclohepta-2,4,6-trien-1-yl]methanamine
N-(fluoromethyl)-1-[3-[(Z)-prop-1-enyl]cyclohepta-2,4,6-trien-1-yl]methanamine (PubChem CID 138478226) has the molecular formula C12H16FN
and a molecular weight of 193.26 g/mol. Its IUPAC name is N-(fluoromethyl)-1-[3-[(Z)-prop-1-enyl]cyclohepta-2,4,6-trien-1-yl]methanamine.
Molecular Properties
| Compound Name | N-(fluoromethyl)-1-[3-[(Z)-prop-1-enyl]cyclohepta-2,4,6-trien-1-yl]methanamine |
| PubChem CID | 138478226 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.26 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | N-(fluoromethyl)-1-[3-[(Z)-prop-1-enyl]cyclohepta-2,4,6-trien-1-yl]methanamine |
| SMILES | C/C=C\C1=CC(CNCF)C=CC=C1 |
| InChI | InChI=1S/C12H16FN/c1-2-5-11-6-3-4-7-12(8-11)9-14-10-13/h2-8,12,14H,9-10H2,1H3/b5-2- |
| InChIKey | QRLRBOOUYIXNFY-DJWKRKHSSA-N |
| XLogP | 2.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(fluoromethyl)-1-[3-[(Z)-prop-1-enyl]cyclohepta-2,4,6-trien-1-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(fluoromethyl)-1-[3-[(Z)-prop-1-enyl]cyclohepta-2,4,6-trien-1-yl]methanamine?
The IUPAC name of N-(fluoromethyl)-1-[3-[(Z)-prop-1-enyl]cyclohepta-2,4,6-trien-1-yl]methanamine (CID 138478226) is N-(fluoromethyl)-1-[3-[(Z)-prop-1-enyl]cyclohepta-2,4,6-trien-1-yl]methanamine.
What is the SMILES notation for N-(fluoromethyl)-1-[3-[(Z)-prop-1-enyl]cyclohepta-2,4,6-trien-1-yl]methanamine?
The canonical SMILES for N-(fluoromethyl)-1-[3-[(Z)-prop-1-enyl]cyclohepta-2,4,6-trien-1-yl]methanamine is C/C=C\C1=CC(CNCF)C=CC=C1.
What is the InChIKey of N-(fluoromethyl)-1-[3-[(Z)-prop-1-enyl]cyclohepta-2,4,6-trien-1-yl]methanamine?
The InChIKey is QRLRBOOUYIXNFY-DJWKRKHSSA-N. The full InChI is InChI=1S/C12H16FN/c1-2-5-11-6-3-4-7-12(8-11)9-14-10-13/h2-8,12,14H,9-10H2,1H3/b5-2-.
What are the key properties of N-(fluoromethyl)-1-[3-[(Z)-prop-1-enyl]cyclohepta-2,4,6-trien-1-yl]methanamine?
N-(fluoromethyl)-1-[3-[(Z)-prop-1-enyl]cyclohepta-2,4,6-trien-1-yl]methanamine has a molecular weight of 193.26 g/mol, XLogP of 2.75, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(fluoromethyl)-1-[3-[(Z)-prop-1-enyl]cyclohepta-2,4,6-trien-1-yl]methanamine is sourced from PubChem (CID 138478226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).