About N-(2,3-dihydrothiophen-2-ylmethyl)prop-1-en-2-amine
N-(2,3-dihydrothiophen-2-ylmethyl)prop-1-en-2-amine (PubChem CID 138478273) has the molecular formula C8H13NS
and a molecular weight of 155.27 g/mol. Its IUPAC name is N-(2,3-dihydrothiophen-2-ylmethyl)prop-1-en-2-amine.
Molecular Properties
| Compound Name | N-(2,3-dihydrothiophen-2-ylmethyl)prop-1-en-2-amine |
| PubChem CID | 138478273 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | N-(2,3-dihydrothiophen-2-ylmethyl)prop-1-en-2-amine |
| SMILES | C=C(C)NCC1CC=CS1 |
| InChI | InChI=1S/C8H13NS/c1-7(2)9-6-8-4-3-5-10-8/h3,5,8-9H,1,4,6H2,2H3 |
| InChIKey | IMNLHANREYWANR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2,3-dihydrothiophen-2-ylmethyl)prop-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dihydrothiophen-2-ylmethyl)prop-1-en-2-amine?
The IUPAC name of N-(2,3-dihydrothiophen-2-ylmethyl)prop-1-en-2-amine (CID 138478273) is N-(2,3-dihydrothiophen-2-ylmethyl)prop-1-en-2-amine.
What is the SMILES notation for N-(2,3-dihydrothiophen-2-ylmethyl)prop-1-en-2-amine?
The canonical SMILES for N-(2,3-dihydrothiophen-2-ylmethyl)prop-1-en-2-amine is C=C(C)NCC1CC=CS1.
What is the InChIKey of N-(2,3-dihydrothiophen-2-ylmethyl)prop-1-en-2-amine?
The InChIKey is IMNLHANREYWANR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NS/c1-7(2)9-6-8-4-3-5-10-8/h3,5,8-9H,1,4,6H2,2H3.
What are the key properties of N-(2,3-dihydrothiophen-2-ylmethyl)prop-1-en-2-amine?
N-(2,3-dihydrothiophen-2-ylmethyl)prop-1-en-2-amine has a molecular weight of 155.27 g/mol, XLogP of 2.13, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dihydrothiophen-2-ylmethyl)prop-1-en-2-amine is sourced from PubChem (CID 138478273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).