C13H23N — CID 138478288
(6Z,8Z)-5,8-dimethylundeca-1,6,8-trien-3-amine (PubChem CID 138478288) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is (6Z,8Z)-5,8-dimethylundeca-1,6,8-trien-3-amine.
| Compound Name | (6Z,8Z)-5,8-dimethylundeca-1,6,8-trien-3-amine |
|---|---|
| PubChem CID | 138478288 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | (6Z,8Z)-5,8-dimethylundeca-1,6,8-trien-3-amine |
| SMILES | C=CC(N)CC(C)/C=C\C(C)=C/CC |
| InChI | InChI=1S/C13H23N/c1-5-7-11(3)8-9-12(4)10-13(14)6-2/h6-9,12-13H,2,5,10,14H2,1,3-4H3/b9-8-,11-7- |
| InChIKey | FEWVHOZNCFELNB-VVPOTFPNSA-N |
| XLogP | 3.44 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|