C9H14FN — CID 138478316
2,2-diethyl-5-fluoro-1H-pyridine (PubChem CID 138478316) has the molecular formula C9H14FN and a molecular weight of 155.22 g/mol. Its IUPAC name is 2,2-diethyl-5-fluoro-1H-pyridine.
| Compound Name | 2,2-diethyl-5-fluoro-1H-pyridine |
|---|---|
| PubChem CID | 138478316 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 2,2-diethyl-5-fluoro-1H-pyridine |
| SMILES | CCC1(CC)C=CC(F)=CN1 |
| InChI | InChI=1S/C9H14FN/c1-3-9(4-2)6-5-8(10)7-11-9/h5-7,11H,3-4H2,1-2H3 |
| InChIKey | RUWXQIIAWMIRIJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |