About bis[(E)-non-2-enyl] 9-(3-methoxypropanoyloxymethyl)heptadecanedioate
bis[(E)-non-2-enyl] 9-(3-methoxypropanoyloxymethyl)heptadecanedioate (PubChem CID 138478553) has the molecular formula C40H72O7
and a molecular weight of 665.01 g/mol. Its IUPAC name is bis[(E)-non-2-enyl] 9-(3-methoxypropanoyloxymethyl)heptadecanedioate.
Molecular Properties
| Compound Name | bis[(E)-non-2-enyl] 9-(3-methoxypropanoyloxymethyl)heptadecanedioate |
| PubChem CID | 138478553 |
| Molecular Formula | C40H72O7 |
| Molecular Weight | 665.01 g/mol |
| Exact Mass | 664.53 |
| IUPAC Name | bis[(E)-non-2-enyl] 9-(3-methoxypropanoyloxymethyl)heptadecanedioate |
| SMILES | CCCCCC/C=C/COC(=O)CCCCCCCC(CCCCCCCC(=O)OC/C=C/CCCCCC)COC(=O)CCOC |
| InChI | InChI=1S/C40H72O7/c1-4-6-8-10-12-20-26-33-45-38(41)30-24-18-14-16-22-28-37(36-47-40(43)32-35-44-3)29-23-17-15-19-25-31-39(42)46-34-27-21-13-11-9-7-5-2/h20-21,26-27,37H,4-19,22-25,28-36H2,1-3H3/b26-20+,27-21+ |
| InChIKey | GYVGBEUPCKBCHN-CRYYDKFDSA-N |
| XLogP | 10.78 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 665.01 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis[(E)-non-2-enyl] 9-(3-methoxypropanoyloxymethyl)heptadecanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(E)-non-2-enyl] 9-(3-methoxypropanoyloxymethyl)heptadecanedioate?
The IUPAC name of bis[(E)-non-2-enyl] 9-(3-methoxypropanoyloxymethyl)heptadecanedioate (CID 138478553) is bis[(E)-non-2-enyl] 9-(3-methoxypropanoyloxymethyl)heptadecanedioate.
What is the SMILES notation for bis[(E)-non-2-enyl] 9-(3-methoxypropanoyloxymethyl)heptadecanedioate?
The canonical SMILES for bis[(E)-non-2-enyl] 9-(3-methoxypropanoyloxymethyl)heptadecanedioate is CCCCCC/C=C/COC(=O)CCCCCCCC(CCCCCCCC(=O)OC/C=C/CCCCCC)COC(=O)CCOC.
What is the InChIKey of bis[(E)-non-2-enyl] 9-(3-methoxypropanoyloxymethyl)heptadecanedioate?
The InChIKey is GYVGBEUPCKBCHN-CRYYDKFDSA-N. The full InChI is InChI=1S/C40H72O7/c1-4-6-8-10-12-20-26-33-45-38(41)30-24-18-14-16-22-28-37(36-47-40(43)32-35-44-3)29-23-17-15-19-25-31-39(42)46-34-27-21-13-11-9-7-5-2/h20-21,26-27,37H,4-19,22-25,28-36H2,1-3H3/b26-20+,27-21+.
What are the key properties of bis[(E)-non-2-enyl] 9-(3-methoxypropanoyloxymethyl)heptadecanedioate?
bis[(E)-non-2-enyl] 9-(3-methoxypropanoyloxymethyl)heptadecanedioate has a molecular weight of 665.01 g/mol, XLogP of 10.78, 35 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(E)-non-2-enyl] 9-(3-methoxypropanoyloxymethyl)heptadecanedioate is sourced from PubChem (CID 138478553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).