About 2-(8,9-difluoro-3-methylnonoxy)-2,9-dimethyldecane
2-(8,9-difluoro-3-methylnonoxy)-2,9-dimethyldecane (PubChem CID 138478654) has the molecular formula C22H44F2O
and a molecular weight of 362.59 g/mol. Its IUPAC name is 2-(8,9-difluoro-3-methylnonoxy)-2,9-dimethyldecane.
Molecular Properties
| Compound Name | 2-(8,9-difluoro-3-methylnonoxy)-2,9-dimethyldecane |
| PubChem CID | 138478654 |
| Molecular Formula | C22H44F2O |
| Molecular Weight | 362.59 g/mol |
| Exact Mass | 362.34 |
| IUPAC Name | 2-(8,9-difluoro-3-methylnonoxy)-2,9-dimethyldecane |
| SMILES | CC(C)CCCCCCC(C)(C)OCCC(C)CCCCC(F)CF |
| InChI | InChI=1S/C22H44F2O/c1-19(2)12-8-6-7-11-16-22(4,5)25-17-15-20(3)13-9-10-14-21(24)18-23/h19-21H,6-18H2,1-5H3 |
| InChIKey | GTKYTVLTSAMDFY-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.59 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(8,9-difluoro-3-methylnonoxy)-2,9-dimethyldecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(8,9-difluoro-3-methylnonoxy)-2,9-dimethyldecane?
The IUPAC name of 2-(8,9-difluoro-3-methylnonoxy)-2,9-dimethyldecane (CID 138478654) is 2-(8,9-difluoro-3-methylnonoxy)-2,9-dimethyldecane.
What is the SMILES notation for 2-(8,9-difluoro-3-methylnonoxy)-2,9-dimethyldecane?
The canonical SMILES for 2-(8,9-difluoro-3-methylnonoxy)-2,9-dimethyldecane is CC(C)CCCCCCC(C)(C)OCCC(C)CCCCC(F)CF.
What is the InChIKey of 2-(8,9-difluoro-3-methylnonoxy)-2,9-dimethyldecane?
The InChIKey is GTKYTVLTSAMDFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H44F2O/c1-19(2)12-8-6-7-11-16-22(4,5)25-17-15-20(3)13-9-10-14-21(24)18-23/h19-21H,6-18H2,1-5H3.
What are the key properties of 2-(8,9-difluoro-3-methylnonoxy)-2,9-dimethyldecane?
2-(8,9-difluoro-3-methylnonoxy)-2,9-dimethyldecane has a molecular weight of 362.59 g/mol, XLogP of 7.67, 17 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(8,9-difluoro-3-methylnonoxy)-2,9-dimethyldecane is sourced from PubChem (CID 138478654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).