C22H29NO4 — CID 138480019
(11aR)-11a-ethyl-6-[ethynyl(methyl)amino]-1-hydroxy-2,8-dimethoxy-6,6a,7,8,9,11-hexahydro-5H-cyclohepta[a]naphthalen-10-one (PubChem CID 138480019) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is (11aR)-11a-ethyl-6-[ethynyl(methyl)amino]-1-hydroxy-2,8-dimethoxy-6,6a,7,8,9,11-hexahydro-5H-cyclohepta[a]naphthalen-10-one.
| Compound Name | (11aR)-11a-ethyl-6-[ethynyl(methyl)amino]-1-hydroxy-2,8-dimethoxy-6,6a,7,8,9,11-hexahydro-5H-cyclohepta[a]naphthalen-10-one |
|---|---|
| PubChem CID | 138480019 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | (11aR)-11a-ethyl-6-[ethynyl(methyl)amino]-1-hydroxy-2,8-dimethoxy-6,6a,7,8,9,11-hexahydro-5H-cyclohepta[a]naphthalen-10-one |
| SMILES | C#CN(C)C1Cc2ccc(OC)c(O)c2[C@]2(CC)CC(=O)CC(OC)CC12 |
| InChI | InChI=1S/C22H29NO4/c1-6-22-13-15(24)11-16(26-4)12-17(22)18(23(3)7-2)10-14-8-9-19(27-5)21(25)20(14)22/h2,8-9,16-18,25H,6,10-13H2,1,3-5H3/t16?,17?,18?,22-/m1/s1 |
| InChIKey | BZVPUXDZUCTCQK-HEGUNSDMSA-N |
| XLogP | 2.88 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|