C33H40ClF4N3O7 — CID 138480116
tert-butyl (3S)-3-[[1-[2-(2-tert-butyl-4-chloroanilino)-2-oxoacetyl]piperidine-4-carbonyl]amino]-4-hydroxy-5-(2,3,5,6-tetrafluorophenoxy)pentanoate (PubChem CID 138480116) has the molecular formula C33H40ClF4N3O7 and a molecular weight of 702.14 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[1-[2-(2-tert-butyl-4-chloroanilino)-2-oxoacetyl]piperidine-4-carbonyl]amino]-4-hydroxy-5-(2,3,5,6-tetrafluorophenoxy)pentanoate.
| Compound Name | tert-butyl (3S)-3-[[1-[2-(2-tert-butyl-4-chloroanilino)-2-oxoacetyl]piperidine-4-carbonyl]amino]-4-hydroxy-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
|---|---|
| PubChem CID | 138480116 |
| Molecular Formula | C33H40ClF4N3O7 |
| Molecular Weight | 702.14 g/mol |
| Exact Mass | 701.25 |
| IUPAC Name | tert-butyl (3S)-3-[[1-[2-(2-tert-butyl-4-chloroanilino)-2-oxoacetyl]piperidine-4-carbonyl]amino]-4-hydroxy-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
| SMILES | CC(C)(C)OC(=O)C[C@H](NC(=O)C1CCN(C(=O)C(=O)Nc2ccc(Cl)cc2C(C)(C)C)CC1)C(O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C33H40ClF4N3O7/c1-32(2,3)19-13-18(34)7-8-22(19)39-30(45)31(46)41-11-9-17(10-12-41)29(44)40-23(15-25(43)48-33(4,5)6)24(42)16-47-28-26(37)20(35)14-21(36)27(28)38/h7-8,13-14,17,23-24,42H,9-12,15-16H2,1-6H3,(H,39,45)(H,40,44)/t23-,24?/m0/s1 |
| InChIKey | XVPKWHBKJDMPKC-UXMRNZNESA-N |
| XLogP | 5.03 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.14 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|