C19H18F4N2O8 — CID 138480153
3-[[(6R)-4-oxaldehydoyl-1,4-oxazepane-6-carbonyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid (PubChem CID 138480153) has the molecular formula C19H18F4N2O8 and a molecular weight of 478.35 g/mol. Its IUPAC name is 3-[[(6R)-4-oxaldehydoyl-1,4-oxazepane-6-carbonyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid.
| Compound Name | 3-[[(6R)-4-oxaldehydoyl-1,4-oxazepane-6-carbonyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
|---|---|
| PubChem CID | 138480153 |
| Molecular Formula | C19H18F4N2O8 |
| Molecular Weight | 478.35 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 3-[[(6R)-4-oxaldehydoyl-1,4-oxazepane-6-carbonyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
| SMILES | O=CC(=O)N1CCOC[C@H](C(=O)NC(CC(=O)O)C(=O)COc2c(F)c(F)cc(F)c2F)C1 |
| InChI | InChI=1S/C19H18F4N2O8/c20-10-3-11(21)17(23)18(16(10)22)33-8-13(27)12(4-15(29)30)24-19(31)9-5-25(14(28)6-26)1-2-32-7-9/h3,6,9,12H,1-2,4-5,7-8H2,(H,24,31)(H,29,30)/t9-,12?/m1/s1 |
| InChIKey | NJHHNDKEXAYTDS-PKEIRNPWSA-N |
| XLogP | -0.18 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.35 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|