C24H28F4N2O6 — CID 138480172
(3S)-3-[[1-(cyclohexanecarbonyl)piperidine-4-carbonyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid (PubChem CID 138480172) has the molecular formula C24H28F4N2O6 and a molecular weight of 516.49 g/mol. Its IUPAC name is (3S)-3-[[1-(cyclohexanecarbonyl)piperidine-4-carbonyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid.
| Compound Name | (3S)-3-[[1-(cyclohexanecarbonyl)piperidine-4-carbonyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
|---|---|
| PubChem CID | 138480172 |
| Molecular Formula | C24H28F4N2O6 |
| Molecular Weight | 516.49 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | (3S)-3-[[1-(cyclohexanecarbonyl)piperidine-4-carbonyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
| SMILES | O=C(O)C[C@H](NC(=O)C1CCN(C(=O)C2CCCCC2)CC1)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C24H28F4N2O6/c25-15-10-16(26)21(28)22(20(15)27)36-12-18(31)17(11-19(32)33)29-23(34)13-6-8-30(9-7-13)24(35)14-4-2-1-3-5-14/h10,13-14,17H,1-9,11-12H2,(H,29,34)(H,32,33)/t17-/m0/s1 |
| InChIKey | DSOWCXXOQYCFFV-KRWDZBQOSA-N |
| XLogP | 2.97 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|