C29H31F4N3O7 — CID 138480174
(3S)-3-[[1-[2-(3-tert-butylanilino)-2-oxoacetyl]piperidine-4-carbonyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid (PubChem CID 138480174) has the molecular formula C29H31F4N3O7 and a molecular weight of 609.57 g/mol. Its IUPAC name is (3S)-3-[[1-[2-(3-tert-butylanilino)-2-oxoacetyl]piperidine-4-carbonyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid.
| Compound Name | (3S)-3-[[1-[2-(3-tert-butylanilino)-2-oxoacetyl]piperidine-4-carbonyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
|---|---|
| PubChem CID | 138480174 |
| Molecular Formula | C29H31F4N3O7 |
| Molecular Weight | 609.57 g/mol |
| Exact Mass | 609.21 |
| IUPAC Name | (3S)-3-[[1-[2-(3-tert-butylanilino)-2-oxoacetyl]piperidine-4-carbonyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
| SMILES | CC(C)(C)c1cccc(NC(=O)C(=O)N2CCC(C(=O)N[C@@H](CC(=O)O)C(=O)COc3c(F)c(F)cc(F)c3F)CC2)c1 |
| InChI | InChI=1S/C29H31F4N3O7/c1-29(2,3)16-5-4-6-17(11-16)34-27(41)28(42)36-9-7-15(8-10-36)26(40)35-20(13-22(38)39)21(37)14-43-25-23(32)18(30)12-19(31)24(25)33/h4-6,11-12,15,20H,7-10,13-14H2,1-3H3,(H,34,41)(H,35,40)(H,38,39)/t20-/m0/s1 |
| InChIKey | WRXHAZYPEFDJCL-FQEVSTJZSA-N |
| XLogP | 3.33 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.57 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|