C16H27NO — CID 138480380
(8Z,10Z)-3,8-dimethyl-1-(methylamino)-7-methylidenedodeca-8,10-dien-6-one (PubChem CID 138480380) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is (8Z,10Z)-3,8-dimethyl-1-(methylamino)-7-methylidenedodeca-8,10-dien-6-one.
| Compound Name | (8Z,10Z)-3,8-dimethyl-1-(methylamino)-7-methylidenedodeca-8,10-dien-6-one |
|---|---|
| PubChem CID | 138480380 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | (8Z,10Z)-3,8-dimethyl-1-(methylamino)-7-methylidenedodeca-8,10-dien-6-one |
| SMILES | C=C(C(=O)CCC(C)CCNC)/C(C)=C\C=C/C |
| InChI | InChI=1S/C16H27NO/c1-6-7-8-14(3)15(4)16(18)10-9-13(2)11-12-17-5/h6-8,13,17H,4,9-12H2,1-3,5H3/b7-6-,14-8- |
| InChIKey | APJQEBNPABHGHT-PMAMELDRSA-N |
| XLogP | 3.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|