C25H32FN — CID 138480382
(Z)-4-fluoro-N-[4-methylidene-7-(3-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)nona-7,8-dien-3-yl]but-2-en-1-imine (PubChem CID 138480382) has the molecular formula C25H32FN and a molecular weight of 365.54 g/mol. Its IUPAC name is (Z)-4-fluoro-N-[4-methylidene-7-(3-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)nona-7,8-dien-3-yl]but-2-en-1-imine.
| Compound Name | (Z)-4-fluoro-N-[4-methylidene-7-(3-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)nona-7,8-dien-3-yl]but-2-en-1-imine |
|---|---|
| PubChem CID | 138480382 |
| Molecular Formula | C25H32FN |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | (Z)-4-fluoro-N-[4-methylidene-7-(3-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)nona-7,8-dien-3-yl]but-2-en-1-imine |
| SMILES | C=C=C(CCC(=C)C(CC)/N=C/C=C\CF)c1cc2c(cc1C)CCCC2 |
| InChI | InChI=1S/C25H32FN/c1-5-21(14-13-19(3)25(6-2)27-16-10-9-15-26)24-18-23-12-8-7-11-22(23)17-20(24)4/h9-10,16-18,25H,1,3,6-8,11-15H2,2,4H3/b10-9-,27-16+ |
| InChIKey | BZPFAZKFRSTGHL-RAJAZVRDSA-N |
| XLogP | 6.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|