About (E)-3-fluoro-4,9-dimethyl-5,8-dimethylidene-4-prop-2-ynyldec-2-ene
(E)-3-fluoro-4,9-dimethyl-5,8-dimethylidene-4-prop-2-ynyldec-2-ene (PubChem CID 138480385) has the molecular formula C17H25F
and a molecular weight of 248.38 g/mol. Its IUPAC name is (E)-3-fluoro-4,9-dimethyl-5,8-dimethylidene-4-prop-2-ynyldec-2-ene.
Molecular Properties
| Compound Name | (E)-3-fluoro-4,9-dimethyl-5,8-dimethylidene-4-prop-2-ynyldec-2-ene |
| PubChem CID | 138480385 |
| Molecular Formula | C17H25F |
| Molecular Weight | 248.38 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | (E)-3-fluoro-4,9-dimethyl-5,8-dimethylidene-4-prop-2-ynyldec-2-ene |
| SMILES | C#CCC(C)(C(=C)CCC(=C)C(C)C)/C(F)=C\C |
| InChI | InChI=1S/C17H25F/c1-8-12-17(7,16(18)9-2)15(6)11-10-14(5)13(3)4/h1,9,13H,5-6,10-12H2,2-4,7H3/b16-9+ |
| InChIKey | XUWFMWQBCKQVDW-CXUHLZMHSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 248.38 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-fluoro-4,9-dimethyl-5,8-dimethylidene-4-prop-2-ynyldec-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-fluoro-4,9-dimethyl-5,8-dimethylidene-4-prop-2-ynyldec-2-ene?
The IUPAC name of (E)-3-fluoro-4,9-dimethyl-5,8-dimethylidene-4-prop-2-ynyldec-2-ene (CID 138480385) is (E)-3-fluoro-4,9-dimethyl-5,8-dimethylidene-4-prop-2-ynyldec-2-ene.
What is the SMILES notation for (E)-3-fluoro-4,9-dimethyl-5,8-dimethylidene-4-prop-2-ynyldec-2-ene?
The canonical SMILES for (E)-3-fluoro-4,9-dimethyl-5,8-dimethylidene-4-prop-2-ynyldec-2-ene is C#CCC(C)(C(=C)CCC(=C)C(C)C)/C(F)=C\C.
What is the InChIKey of (E)-3-fluoro-4,9-dimethyl-5,8-dimethylidene-4-prop-2-ynyldec-2-ene?
The InChIKey is XUWFMWQBCKQVDW-CXUHLZMHSA-N. The full InChI is InChI=1S/C17H25F/c1-8-12-17(7,16(18)9-2)15(6)11-10-14(5)13(3)4/h1,9,13H,5-6,10-12H2,2-4,7H3/b16-9+.
What are the key properties of (E)-3-fluoro-4,9-dimethyl-5,8-dimethylidene-4-prop-2-ynyldec-2-ene?
(E)-3-fluoro-4,9-dimethyl-5,8-dimethylidene-4-prop-2-ynyldec-2-ene has a molecular weight of 248.38 g/mol, XLogP of 5.44, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-fluoro-4,9-dimethyl-5,8-dimethylidene-4-prop-2-ynyldec-2-ene is sourced from PubChem (CID 138480385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).