C30H31ClF7N3O7 — CID 138480412
tert-butyl (3S)-3-[[1-[2-[5-chloro-2-(trifluoromethyl)anilino]-2-oxoacetyl]piperidine-4-carbonyl]amino]-4-hydroxy-5-(2,3,5,6-tetrafluorophenoxy)pentanoate (PubChem CID 138480412) has the molecular formula C30H31ClF7N3O7 and a molecular weight of 714.03 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[1-[2-[5-chloro-2-(trifluoromethyl)anilino]-2-oxoacetyl]piperidine-4-carbonyl]amino]-4-hydroxy-5-(2,3,5,6-tetrafluorophenoxy)pentanoate.
| Compound Name | tert-butyl (3S)-3-[[1-[2-[5-chloro-2-(trifluoromethyl)anilino]-2-oxoacetyl]piperidine-4-carbonyl]amino]-4-hydroxy-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
|---|---|
| PubChem CID | 138480412 |
| Molecular Formula | C30H31ClF7N3O7 |
| Molecular Weight | 714.03 g/mol |
| Exact Mass | 713.17 |
| IUPAC Name | tert-butyl (3S)-3-[[1-[2-[5-chloro-2-(trifluoromethyl)anilino]-2-oxoacetyl]piperidine-4-carbonyl]amino]-4-hydroxy-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
| SMILES | CC(C)(C)OC(=O)C[C@H](NC(=O)C1CCN(C(=O)C(=O)Nc2cc(Cl)ccc2C(F)(F)F)CC1)C(O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C30H31ClF7N3O7/c1-29(2,3)48-22(43)12-20(21(42)13-47-25-23(34)17(32)11-18(33)24(25)35)40-26(44)14-6-8-41(9-7-14)28(46)27(45)39-19-10-15(31)4-5-16(19)30(36,37)38/h4-5,10-11,14,20-21,42H,6-9,12-13H2,1-3H3,(H,39,45)(H,40,44)/t20-,21?/m0/s1 |
| InChIKey | YINHJWUMHLVHML-BGERDNNASA-N |
| XLogP | 4.75 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.03 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|