C16H19F3 — CID 138480478
(1E,3E)-4-[(E)-hex-2-en-3-yl]-2-methyl-1-(trifluoromethyl)cycloocta-1,3-dien-6-yne (PubChem CID 138480478) has the molecular formula C16H19F3 and a molecular weight of 268.32 g/mol. Its IUPAC name is (1E,3E)-4-[(E)-hex-2-en-3-yl]-2-methyl-1-(trifluoromethyl)cycloocta-1,3-dien-6-yne.
| Compound Name | (1E,3E)-4-[(E)-hex-2-en-3-yl]-2-methyl-1-(trifluoromethyl)cycloocta-1,3-dien-6-yne |
|---|---|
| PubChem CID | 138480478 |
| Molecular Formula | C16H19F3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | (1E,3E)-4-[(E)-hex-2-en-3-yl]-2-methyl-1-(trifluoromethyl)cycloocta-1,3-dien-6-yne |
| SMILES | C/C=C(CCC)/C1=C/C(C)=C(/C(F)(F)F)CC#CC1 |
| InChI | InChI=1S/C16H19F3/c1-4-8-13(5-2)14-9-6-7-10-15(12(3)11-14)16(17,18)19/h5,11H,4,8-10H2,1-3H3/b13-5+,14-11+,15-12+ |
| InChIKey | GXGXFBKHDRRTIV-AXCJDZFESA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|