C23H33NO — CID 138480997
(5Z,8Z,11Z,14Z,17Z,20Z)-1-iminotricosa-5,8,11,14,17,20-hexaen-2-one (PubChem CID 138480997) has the molecular formula C23H33NO and a molecular weight of 339.52 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z,17Z,20Z)-1-iminotricosa-5,8,11,14,17,20-hexaen-2-one.
| Compound Name | (5Z,8Z,11Z,14Z,17Z,20Z)-1-iminotricosa-5,8,11,14,17,20-hexaen-2-one |
|---|---|
| PubChem CID | 138480997 |
| Molecular Formula | C23H33NO |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | (5Z,8Z,11Z,14Z,17Z,20Z)-1-iminotricosa-5,8,11,14,17,20-hexaen-2-one |
| SMILES | [H]/N=C/C(=O)CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC |
| InChI | InChI=1S/C23H33NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23(25)22-24/h3-4,6-7,9-10,12-13,15-16,18-19,22,24H,2,5,8,11,14,17,20-21H2,1H3/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18-,24-22+ |
| InChIKey | DWEBKTNXBKLBLY-QDVLRYEOSA-N |
| XLogP | 6.68 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|