C21H31F3OS — CID 138481038
1,1,1-trifluoro-3-[(2E,6Z,9Z,12Z,15Z)-octadeca-2,6,9,12,15-pentaenyl]sulfanylpropan-2-ol (PubChem CID 138481038) has the molecular formula C21H31F3OS and a molecular weight of 388.54 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[(2E,6Z,9Z,12Z,15Z)-octadeca-2,6,9,12,15-pentaenyl]sulfanylpropan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[(2E,6Z,9Z,12Z,15Z)-octadeca-2,6,9,12,15-pentaenyl]sulfanylpropan-2-ol |
|---|---|
| PubChem CID | 138481038 |
| Molecular Formula | C21H31F3OS |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 1,1,1-trifluoro-3-[(2E,6Z,9Z,12Z,15Z)-octadeca-2,6,9,12,15-pentaenyl]sulfanylpropan-2-ol |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CC/C=C/CSCC(O)C(F)(F)F |
| InChI | InChI=1S/C21H31F3OS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-26-19-20(25)21(22,23)24/h3-4,6-7,9-10,12-13,16-17,20,25H,2,5,8,11,14-15,18-19H2,1H3/b4-3-,7-6-,10-9-,13-12-,17-16+ |
| InChIKey | XKFCIVGCNVJCTP-IIFHDYRKSA-N |
| XLogP | 6.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|