About 3-(difluoromethoxy)-N,1-dimethylpyrazol-4-amine
3-(difluoromethoxy)-N,1-dimethylpyrazol-4-amine (PubChem CID 138481082) has the molecular formula C6H9F2N3O
and a molecular weight of 177.15 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N,1-dimethylpyrazol-4-amine.
Molecular Properties
| Compound Name | 3-(difluoromethoxy)-N,1-dimethylpyrazol-4-amine |
| PubChem CID | 138481082 |
| Molecular Formula | C6H9F2N3O |
| Molecular Weight | 177.15 g/mol |
| Exact Mass | 177.07 |
| IUPAC Name | 3-(difluoromethoxy)-N,1-dimethylpyrazol-4-amine |
| SMILES | CNc1cn(C)nc1OC(F)F |
| InChI | InChI=1S/C6H9F2N3O/c1-9-4-3-11(2)10-5(4)12-6(7)8/h3,6,9H,1-2H3 |
| InChIKey | GESRHSTUJGDJIV-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.15 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(difluoromethoxy)-N,1-dimethylpyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethoxy)-N,1-dimethylpyrazol-4-amine?
The IUPAC name of 3-(difluoromethoxy)-N,1-dimethylpyrazol-4-amine (CID 138481082) is 3-(difluoromethoxy)-N,1-dimethylpyrazol-4-amine.
What is the SMILES notation for 3-(difluoromethoxy)-N,1-dimethylpyrazol-4-amine?
The canonical SMILES for 3-(difluoromethoxy)-N,1-dimethylpyrazol-4-amine is CNc1cn(C)nc1OC(F)F.
What is the InChIKey of 3-(difluoromethoxy)-N,1-dimethylpyrazol-4-amine?
The InChIKey is GESRHSTUJGDJIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F2N3O/c1-9-4-3-11(2)10-5(4)12-6(7)8/h3,6,9H,1-2H3.
What are the key properties of 3-(difluoromethoxy)-N,1-dimethylpyrazol-4-amine?
3-(difluoromethoxy)-N,1-dimethylpyrazol-4-amine has a molecular weight of 177.15 g/mol, XLogP of 1.06, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethoxy)-N,1-dimethylpyrazol-4-amine is sourced from PubChem (CID 138481082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).