C9H3Br2NS2 — CID 138481108
4,11-dibromo-3,12-dithia-7-azatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene (PubChem CID 138481108) has the molecular formula C9H3Br2NS2 and a molecular weight of 349.07 g/mol. Its IUPAC name is 4,11-dibromo-3,12-dithia-7-azatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene.
| Compound Name | 4,11-dibromo-3,12-dithia-7-azatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene |
|---|---|
| PubChem CID | 138481108 |
| Molecular Formula | C9H3Br2NS2 |
| Molecular Weight | 349.07 g/mol |
| Exact Mass | 346.81 |
| IUPAC Name | 4,11-dibromo-3,12-dithia-7-azatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene |
| SMILES | Brc1cc2cnc3cc(Br)sc3c2s1 |
| InChI | InChI=1S/C9H3Br2NS2/c10-6-1-4-3-12-5-2-7(11)14-9(5)8(4)13-6/h1-3H |
| InChIKey | RHAAGYALVOLPEC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.07 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |