C8H14N2 — CID 138481376
2-[(3Z)-hexa-1,3,5-trien-2-yl]-1,1-dimethylhydrazine (PubChem CID 138481376) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 2-[(3Z)-hexa-1,3,5-trien-2-yl]-1,1-dimethylhydrazine.
| Compound Name | 2-[(3Z)-hexa-1,3,5-trien-2-yl]-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 138481376 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 2-[(3Z)-hexa-1,3,5-trien-2-yl]-1,1-dimethylhydrazine |
| SMILES | C=C/C=C\C(=C)NN(C)C |
| InChI | InChI=1S/C8H14N2/c1-5-6-7-8(2)9-10(3)4/h5-7,9H,1-2H2,3-4H3/b7-6- |
| InChIKey | YPFWEDZPZSAPQP-SREVYHEPSA-N |
| XLogP | 1.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|