C18H11BrO — CID 138481410
2-bromo-1-phenyldibenzofuran (PubChem CID 138481410) has the molecular formula C18H11BrO and a molecular weight of 323.19 g/mol. Its IUPAC name is 2-bromo-1-phenyldibenzofuran.
| Compound Name | 2-bromo-1-phenyldibenzofuran |
|---|---|
| PubChem CID | 138481410 |
| Molecular Formula | C18H11BrO |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 2-bromo-1-phenyldibenzofuran |
| SMILES | Brc1ccc2oc3ccccc3c2c1-c1ccccc1 |
| InChI | InChI=1S/C18H11BrO/c19-14-10-11-16-18(13-8-4-5-9-15(13)20-16)17(14)12-6-2-1-3-7-12/h1-11H |
| InChIKey | WWUSVMXINOLRPM-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |