C18H17IS — CID 138481869
12-iodo-1,2,3,4,7,12-hexahydronaphtho[2,3-c][2]benzothiepine (PubChem CID 138481869) has the molecular formula C18H17IS and a molecular weight of 392.31 g/mol. Its IUPAC name is 12-iodo-1,2,3,4,7,12-hexahydronaphtho[2,3-c][2]benzothiepine.
| Compound Name | 12-iodo-1,2,3,4,7,12-hexahydronaphtho[2,3-c][2]benzothiepine |
|---|---|
| PubChem CID | 138481869 |
| Molecular Formula | C18H17IS |
| Molecular Weight | 392.31 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | 12-iodo-1,2,3,4,7,12-hexahydronaphtho[2,3-c][2]benzothiepine |
| SMILES | IC1c2ccccc2CSc2cc3c(cc21)CCCC3 |
| InChI | InChI=1S/C18H17IS/c19-18-15-8-4-3-7-14(15)11-20-17-10-13-6-2-1-5-12(13)9-16(17)18/h3-4,7-10,18H,1-2,5-6,11H2 |
| InChIKey | AWZQIVZERPTRFU-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.31 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|