C14H17IO — CID 138482138
11-iodo-1,2,3,4,4a,6,11,11a-octahydrobenzo[c][1]benzoxepine (PubChem CID 138482138) has the molecular formula C14H17IO and a molecular weight of 328.19 g/mol. Its IUPAC name is 11-iodo-1,2,3,4,4a,6,11,11a-octahydrobenzo[c][1]benzoxepine.
| Compound Name | 11-iodo-1,2,3,4,4a,6,11,11a-octahydrobenzo[c][1]benzoxepine |
|---|---|
| PubChem CID | 138482138 |
| Molecular Formula | C14H17IO |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 11-iodo-1,2,3,4,4a,6,11,11a-octahydrobenzo[c][1]benzoxepine |
| SMILES | IC1c2ccccc2COC2CCCCC21 |
| InChI | InChI=1S/C14H17IO/c15-14-11-6-2-1-5-10(11)9-16-13-8-4-3-7-12(13)14/h1-2,5-6,12-14H,3-4,7-9H2 |
| InChIKey | ULFJAGFHALJVRE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|