C35H32ClF3N6O3 — CID 138482522
2,2,2-trifluoroethyl 4-[3-[(1S)-1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-3-phenylpropyl]phenyl]piperidine-1-carboxylate (PubChem CID 138482522) has the molecular formula C35H32ClF3N6O3 and a molecular weight of 677.13 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 4-[3-[(1S)-1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-3-phenylpropyl]phenyl]piperidine-1-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 4-[3-[(1S)-1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-3-phenylpropyl]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 138482522 |
| Molecular Formula | C35H32ClF3N6O3 |
| Molecular Weight | 677.13 g/mol |
| Exact Mass | 676.22 |
| IUPAC Name | 2,2,2-trifluoroethyl 4-[3-[(1S)-1-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-3-phenylpropyl]phenyl]piperidine-1-carboxylate |
| SMILES | O=C(OCC(F)(F)F)N1CCC(c2cccc([C@H](CCc3ccccc3)c3ccc(-c4cc(Cl)ccc4-n4cnnn4)c[n+]3[O-])c2)CC1 |
| InChI | InChI=1S/C35H32ClF3N6O3/c36-29-11-14-32(44-23-40-41-42-44)31(20-29)28-10-13-33(45(47)21-28)30(12-9-24-5-2-1-3-6-24)27-8-4-7-26(19-27)25-15-17-43(18-16-25)34(46)48-22-35(37,38)39/h1-8,10-11,13-14,19-21,23,25,30H,9,12,15-18,22H2/t30-/m0/s1 |
| InChIKey | HRIIPEMKGBJZPZ-PMERELPUSA-N |
| XLogP | 7.26 |
| TPSA | 100.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.13 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|