C10H15NO — CID 138482575
(1E)-1-(5-methyl-1,2,3,6-tetrahydropyridin-4-yl)buta-1,3-dien-1-ol (PubChem CID 138482575) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (1E)-1-(5-methyl-1,2,3,6-tetrahydropyridin-4-yl)buta-1,3-dien-1-ol.
| Compound Name | (1E)-1-(5-methyl-1,2,3,6-tetrahydropyridin-4-yl)buta-1,3-dien-1-ol |
|---|---|
| PubChem CID | 138482575 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (1E)-1-(5-methyl-1,2,3,6-tetrahydropyridin-4-yl)buta-1,3-dien-1-ol |
| SMILES | C=C/C=C(/O)C1=C(C)CNCC1 |
| InChI | InChI=1S/C10H15NO/c1-3-4-10(12)9-5-6-11-7-8(9)2/h3-4,11-12H,1,5-7H2,2H3/b10-4+ |
| InChIKey | QRFANZLCNFDZGQ-ONNFQVAWSA-N |
| XLogP | 1.92 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|