About 6-[[6-(1H-imidazol-2-ylmethyl)-1H-benzimidazol-2-yl]methyl]-1,2-dimethylbenzimidazole
6-[[6-(1H-imidazol-2-ylmethyl)-1H-benzimidazol-2-yl]methyl]-1,2-dimethylbenzimidazole (PubChem CID 138482837) has the molecular formula C21H20N6
and a molecular weight of 356.43 g/mol. Its IUPAC name is 6-[[6-(1H-imidazol-2-ylmethyl)-1H-benzimidazol-2-yl]methyl]-1,2-dimethylbenzimidazole.
Molecular Properties
| Compound Name | 6-[[6-(1H-imidazol-2-ylmethyl)-1H-benzimidazol-2-yl]methyl]-1,2-dimethylbenzimidazole |
| PubChem CID | 138482837 |
| Molecular Formula | C21H20N6 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 6-[[6-(1H-imidazol-2-ylmethyl)-1H-benzimidazol-2-yl]methyl]-1,2-dimethylbenzimidazole |
| SMILES | Cc1nc2ccc(Cc3nc4ccc(Cc5ncc[nH]5)cc4[nH]3)cc2n1C |
| InChI | InChI=1S/C21H20N6/c1-13-24-17-6-4-15(10-19(17)27(13)2)12-21-25-16-5-3-14(9-18(16)26-21)11-20-22-7-8-23-20/h3-10H,11-12H2,1-2H3,(H,22,23)(H,25,26) |
| InChIKey | WCCQXNDXRKJKNT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 75.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[[6-(1H-imidazol-2-ylmethyl)-1H-benzimidazol-2-yl]methyl]-1,2-dimethylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[6-(1H-imidazol-2-ylmethyl)-1H-benzimidazol-2-yl]methyl]-1,2-dimethylbenzimidazole?
The IUPAC name of 6-[[6-(1H-imidazol-2-ylmethyl)-1H-benzimidazol-2-yl]methyl]-1,2-dimethylbenzimidazole (CID 138482837) is 6-[[6-(1H-imidazol-2-ylmethyl)-1H-benzimidazol-2-yl]methyl]-1,2-dimethylbenzimidazole.
What is the SMILES notation for 6-[[6-(1H-imidazol-2-ylmethyl)-1H-benzimidazol-2-yl]methyl]-1,2-dimethylbenzimidazole?
The canonical SMILES for 6-[[6-(1H-imidazol-2-ylmethyl)-1H-benzimidazol-2-yl]methyl]-1,2-dimethylbenzimidazole is Cc1nc2ccc(Cc3nc4ccc(Cc5ncc[nH]5)cc4[nH]3)cc2n1C.
What is the InChIKey of 6-[[6-(1H-imidazol-2-ylmethyl)-1H-benzimidazol-2-yl]methyl]-1,2-dimethylbenzimidazole?
The InChIKey is WCCQXNDXRKJKNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N6/c1-13-24-17-6-4-15(10-19(17)27(13)2)12-21-25-16-5-3-14(9-18(16)26-21)11-20-22-7-8-23-20/h3-10H,11-12H2,1-2H3,(H,22,23)(H,25,26).
What are the key properties of 6-[[6-(1H-imidazol-2-ylmethyl)-1H-benzimidazol-2-yl]methyl]-1,2-dimethylbenzimidazole?
6-[[6-(1H-imidazol-2-ylmethyl)-1H-benzimidazol-2-yl]methyl]-1,2-dimethylbenzimidazole has a molecular weight of 356.43 g/mol, XLogP of 3.66, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[6-(1H-imidazol-2-ylmethyl)-1H-benzimidazol-2-yl]methyl]-1,2-dimethylbenzimidazole is sourced from PubChem (CID 138482837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).