C20H31N3O — CID 138482839
1-[1-(cyclohexylmethyl)-5-[(2E,4Z)-2-methylhepta-2,4,6-trienoxy]pyrazol-3-yl]-N-methylmethanamine (PubChem CID 138482839) has the molecular formula C20H31N3O and a molecular weight of 329.49 g/mol. Its IUPAC name is 1-[1-(cyclohexylmethyl)-5-[(2E,4Z)-2-methylhepta-2,4,6-trienoxy]pyrazol-3-yl]-N-methylmethanamine.
| Compound Name | 1-[1-(cyclohexylmethyl)-5-[(2E,4Z)-2-methylhepta-2,4,6-trienoxy]pyrazol-3-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 138482839 |
| Molecular Formula | C20H31N3O |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | 1-[1-(cyclohexylmethyl)-5-[(2E,4Z)-2-methylhepta-2,4,6-trienoxy]pyrazol-3-yl]-N-methylmethanamine |
| SMILES | C=C/C=C\C=C(/C)COc1cc(CNC)nn1CC1CCCCC1 |
| InChI | InChI=1S/C20H31N3O/c1-4-5-7-10-17(2)16-24-20-13-19(14-21-3)22-23(20)15-18-11-8-6-9-12-18/h4-5,7,10,13,18,21H,1,6,8-9,11-12,14-16H2,2-3H3/b7-5-,17-10+ |
| InChIKey | GOTBTQSXWNZFSA-HXUVOAHHSA-N |
| XLogP | 4.25 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|