C29H36ClF2N3O2 — CID 138483382
3-[[4-chloro-3-[4-[(1E,3E)-4-(2,2-dimethylbutoxy)hexa-1,3,5-trienyl]-6-methyl-1,3,5-triazin-2-yl]phenyl]methyl]-4,4-difluorohexanal (PubChem CID 138483382) has the molecular formula C29H36ClF2N3O2 and a molecular weight of 532.08 g/mol. Its IUPAC name is 3-[[4-chloro-3-[4-[(1E,3E)-4-(2,2-dimethylbutoxy)hexa-1,3,5-trienyl]-6-methyl-1,3,5-triazin-2-yl]phenyl]methyl]-4,4-difluorohexanal.
| Compound Name | 3-[[4-chloro-3-[4-[(1E,3E)-4-(2,2-dimethylbutoxy)hexa-1,3,5-trienyl]-6-methyl-1,3,5-triazin-2-yl]phenyl]methyl]-4,4-difluorohexanal |
|---|---|
| PubChem CID | 138483382 |
| Molecular Formula | C29H36ClF2N3O2 |
| Molecular Weight | 532.08 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | 3-[[4-chloro-3-[4-[(1E,3E)-4-(2,2-dimethylbutoxy)hexa-1,3,5-trienyl]-6-methyl-1,3,5-triazin-2-yl]phenyl]methyl]-4,4-difluorohexanal |
| SMILES | C=C/C(=C\C=C\c1nc(C)nc(-c2cc(CC(CC=O)C(F)(F)CC)ccc2Cl)n1)OCC(C)(C)CC |
| InChI | InChI=1S/C29H36ClF2N3O2/c1-7-23(37-19-28(5,6)8-2)11-10-12-26-33-20(4)34-27(35-26)24-18-21(13-14-25(24)30)17-22(15-16-36)29(31,32)9-3/h7,10-14,16,18,22H,1,8-9,15,17,19H2,2-6H3/b12-10+,23-11+ |
| InChIKey | YSEPZEWSNOZROM-BNFPQAKFSA-N |
| XLogP | 7.83 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.08 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|