About 1-[(4Z)-hepta-4,6-dien-2-yl]piperazin-2-one
1-[(4Z)-hepta-4,6-dien-2-yl]piperazin-2-one (PubChem CID 138483667) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-[(4Z)-hepta-4,6-dien-2-yl]piperazin-2-one.
Molecular Properties
| Compound Name | 1-[(4Z)-hepta-4,6-dien-2-yl]piperazin-2-one |
| PubChem CID | 138483667 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 1-[(4Z)-hepta-4,6-dien-2-yl]piperazin-2-one |
| SMILES | C=C/C=C\CC(C)N1CCNCC1=O |
| InChI | InChI=1S/C11H18N2O/c1-3-4-5-6-10(2)13-8-7-12-9-11(13)14/h3-5,10,12H,1,6-9H2,2H3/b5-4- |
| InChIKey | IYVGFSKHJCTSIY-PLNGDYQASA-N |
| XLogP | 0.94 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4Z)-hepta-4,6-dien-2-yl]piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4Z)-hepta-4,6-dien-2-yl]piperazin-2-one?
The IUPAC name of 1-[(4Z)-hepta-4,6-dien-2-yl]piperazin-2-one (CID 138483667) is 1-[(4Z)-hepta-4,6-dien-2-yl]piperazin-2-one.
What is the SMILES notation for 1-[(4Z)-hepta-4,6-dien-2-yl]piperazin-2-one?
The canonical SMILES for 1-[(4Z)-hepta-4,6-dien-2-yl]piperazin-2-one is C=C/C=C\CC(C)N1CCNCC1=O.
What is the InChIKey of 1-[(4Z)-hepta-4,6-dien-2-yl]piperazin-2-one?
The InChIKey is IYVGFSKHJCTSIY-PLNGDYQASA-N. The full InChI is InChI=1S/C11H18N2O/c1-3-4-5-6-10(2)13-8-7-12-9-11(13)14/h3-5,10,12H,1,6-9H2,2H3/b5-4-.
What are the key properties of 1-[(4Z)-hepta-4,6-dien-2-yl]piperazin-2-one?
1-[(4Z)-hepta-4,6-dien-2-yl]piperazin-2-one has a molecular weight of 194.28 g/mol, XLogP of 0.94, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4Z)-hepta-4,6-dien-2-yl]piperazin-2-one is sourced from PubChem (CID 138483667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).