C19H19ClF3N5O2 — CID 138484363
(Z,4Z)-2-chloro-4-(methylhydrazinylidene)-3-[3-oxo-1-[[2-(trifluoromethyl)phenyl]methyl]-2,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]but-2-enal (PubChem CID 138484363) has the molecular formula C19H19ClF3N5O2 and a molecular weight of 441.84 g/mol. Its IUPAC name is (Z,4Z)-2-chloro-4-(methylhydrazinylidene)-3-[3-oxo-1-[[2-(trifluoromethyl)phenyl]methyl]-2,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]but-2-enal.
| Compound Name | (Z,4Z)-2-chloro-4-(methylhydrazinylidene)-3-[3-oxo-1-[[2-(trifluoromethyl)phenyl]methyl]-2,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]but-2-enal |
|---|---|
| PubChem CID | 138484363 |
| Molecular Formula | C19H19ClF3N5O2 |
| Molecular Weight | 441.84 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | (Z,4Z)-2-chloro-4-(methylhydrazinylidene)-3-[3-oxo-1-[[2-(trifluoromethyl)phenyl]methyl]-2,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]but-2-enal |
| SMILES | CN/N=C\C(=C(\Cl)C=O)N1CCc2c(c(=O)[nH]n2Cc2ccccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C19H19ClF3N5O2/c1-24-25-8-17(15(20)11-29)27-7-6-16-13(10-27)18(30)26-28(16)9-12-4-2-3-5-14(12)19(21,22)23/h2-5,8,11,24H,6-7,9-10H2,1H3,(H,26,30)/b17-15-,25-8- |
| InChIKey | RRHBXXSRCQDCAP-PEPDLLBJSA-N |
| XLogP | 2.46 |
| TPSA | 82.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.84 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|