C19H28ClN5O — CID 138484375
5-chloro-4-[4-[(E,3S)-5-(methylideneamino)-4-[(Z)-prop-1-enyl]hept-4-en-3-yl]piperazin-1-yl]-1H-pyridazin-6-one (PubChem CID 138484375) has the molecular formula C19H28ClN5O and a molecular weight of 377.92 g/mol. Its IUPAC name is 5-chloro-4-[4-[(E,3S)-5-(methylideneamino)-4-[(Z)-prop-1-enyl]hept-4-en-3-yl]piperazin-1-yl]-1H-pyridazin-6-one.
| Compound Name | 5-chloro-4-[4-[(E,3S)-5-(methylideneamino)-4-[(Z)-prop-1-enyl]hept-4-en-3-yl]piperazin-1-yl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 138484375 |
| Molecular Formula | C19H28ClN5O |
| Molecular Weight | 377.92 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 5-chloro-4-[4-[(E,3S)-5-(methylideneamino)-4-[(Z)-prop-1-enyl]hept-4-en-3-yl]piperazin-1-yl]-1H-pyridazin-6-one |
| SMILES | C=N/C(CC)=C(\C=C/C)[C@H](CC)N1CCN(c2cn[nH]c(=O)c2Cl)CC1 |
| InChI | InChI=1S/C19H28ClN5O/c1-5-8-14(15(6-2)21-4)16(7-3)24-9-11-25(12-10-24)17-13-22-23-19(26)18(17)20/h5,8,13,16H,4,6-7,9-12H2,1-3H3,(H,23,26)/b8-5-,15-14+/t16-/m0/s1 |
| InChIKey | JGNLECMEQBBKDQ-DDZCOKDOSA-N |
| XLogP | 3.26 |
| TPSA | 64.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.92 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|