C18H20F3N3O2 — CID 138485086
4-[4-methyl-5-[[3-(trifluoromethyl)phenoxy]methyl]-1,2,4-triazol-3-yl]cyclohexane-1-carbaldehyde (PubChem CID 138485086) has the molecular formula C18H20F3N3O2 and a molecular weight of 367.37 g/mol. Its IUPAC name is 4-[4-methyl-5-[[3-(trifluoromethyl)phenoxy]methyl]-1,2,4-triazol-3-yl]cyclohexane-1-carbaldehyde.
| Compound Name | 4-[4-methyl-5-[[3-(trifluoromethyl)phenoxy]methyl]-1,2,4-triazol-3-yl]cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 138485086 |
| Molecular Formula | C18H20F3N3O2 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 4-[4-methyl-5-[[3-(trifluoromethyl)phenoxy]methyl]-1,2,4-triazol-3-yl]cyclohexane-1-carbaldehyde |
| SMILES | Cn1c(COc2cccc(C(F)(F)F)c2)nnc1C1CCC(C=O)CC1 |
| InChI | InChI=1S/C18H20F3N3O2/c1-24-16(11-26-15-4-2-3-14(9-15)18(19,20)21)22-23-17(24)13-7-5-12(10-25)6-8-13/h2-4,9-10,12-13H,5-8,11H2,1H3 |
| InChIKey | DQOWQJYBIZKOAL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|