About (1S,2S)-1-(methylamino)-2-phenyl-1,3-dihydroinden-2-ol
(1S,2S)-1-(methylamino)-2-phenyl-1,3-dihydroinden-2-ol (PubChem CID 138485256) has the molecular formula C16H17NO
and a molecular weight of 239.32 g/mol. Its IUPAC name is (1S,2S)-1-(methylamino)-2-phenyl-1,3-dihydroinden-2-ol.
Molecular Properties
| Compound Name | (1S,2S)-1-(methylamino)-2-phenyl-1,3-dihydroinden-2-ol |
| PubChem CID | 138485256 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | (1S,2S)-1-(methylamino)-2-phenyl-1,3-dihydroinden-2-ol |
| SMILES | CN[C@H]1c2ccccc2C[C@]1(O)c1ccccc1 |
| InChI | InChI=1S/C16H17NO/c1-17-15-14-10-6-5-7-12(14)11-16(15,18)13-8-3-2-4-9-13/h2-10,15,17-18H,11H2,1H3/t15-,16-/m0/s1 |
| InChIKey | XNMJZIZQWKEIIW-HOTGVXAUSA-N |
| XLogP | 2.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S,2S)-1-(methylamino)-2-phenyl-1,3-dihydroinden-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2S)-1-(methylamino)-2-phenyl-1,3-dihydroinden-2-ol?
The IUPAC name of (1S,2S)-1-(methylamino)-2-phenyl-1,3-dihydroinden-2-ol (CID 138485256) is (1S,2S)-1-(methylamino)-2-phenyl-1,3-dihydroinden-2-ol.
What is the SMILES notation for (1S,2S)-1-(methylamino)-2-phenyl-1,3-dihydroinden-2-ol?
The canonical SMILES for (1S,2S)-1-(methylamino)-2-phenyl-1,3-dihydroinden-2-ol is CN[C@H]1c2ccccc2C[C@]1(O)c1ccccc1.
What is the InChIKey of (1S,2S)-1-(methylamino)-2-phenyl-1,3-dihydroinden-2-ol?
The InChIKey is XNMJZIZQWKEIIW-HOTGVXAUSA-N. The full InChI is InChI=1S/C16H17NO/c1-17-15-14-10-6-5-7-12(14)11-16(15,18)13-8-3-2-4-9-13/h2-10,15,17-18H,11H2,1H3/t15-,16-/m0/s1.
What are the key properties of (1S,2S)-1-(methylamino)-2-phenyl-1,3-dihydroinden-2-ol?
(1S,2S)-1-(methylamino)-2-phenyl-1,3-dihydroinden-2-ol has a molecular weight of 239.32 g/mol, XLogP of 2.39, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2S)-1-(methylamino)-2-phenyl-1,3-dihydroinden-2-ol is sourced from PubChem (CID 138485256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).