C30H32N2O9S2 — CID 138485297
2-(9-imino-2,2,4-trimethyl-10,12-disulfo-3,4-dihydro-1H-chromeno[3,2-g]quinolin-6-yl)-4-(2-methylpropyl)benzoic acid (PubChem CID 138485297) has the molecular formula C30H32N2O9S2 and a molecular weight of 628.73 g/mol. Its IUPAC name is 2-(9-imino-2,2,4-trimethyl-10,12-disulfo-3,4-dihydro-1H-chromeno[3,2-g]quinolin-6-yl)-4-(2-methylpropyl)benzoic acid.
| Compound Name | 2-(9-imino-2,2,4-trimethyl-10,12-disulfo-3,4-dihydro-1H-chromeno[3,2-g]quinolin-6-yl)-4-(2-methylpropyl)benzoic acid |
|---|---|
| PubChem CID | 138485297 |
| Molecular Formula | C30H32N2O9S2 |
| Molecular Weight | 628.73 g/mol |
| Exact Mass | 628.15 |
| IUPAC Name | 2-(9-imino-2,2,4-trimethyl-10,12-disulfo-3,4-dihydro-1H-chromeno[3,2-g]quinolin-6-yl)-4-(2-methylpropyl)benzoic acid |
| SMILES | [H]/N=c1\ccc2c(-c3cc(CC(C)C)ccc3C(=O)O)c3cc4c(c(S(=O)(=O)O)c3oc-2c1S(=O)(=O)O)NC(C)(C)CC4C |
| InChI | InChI=1S/C30H32N2O9S2/c1-14(2)10-16-6-7-17(29(33)34)20(11-16)23-18-8-9-22(31)27(42(35,36)37)25(18)41-26-21(23)12-19-15(3)13-30(4,5)32-24(19)28(26)43(38,39)40/h6-9,11-12,14-15,31-32H,10,13H2,1-5H3,(H,33,34)(H,35,36,37)(H,38,39,40)/b31-22+ |
| InChIKey | CTVIXXSAAGHJDD-DFKUXCBWSA-N |
| XLogP | 5.77 |
| TPSA | 195.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.73 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|